C14H14Cl2N2O2S — CID 43606048
3,4-dichloro-N-[2-(methylaminomethyl)phenyl]benzenesulfonamide (PubChem CID 43606048) has the molecular formula C14H14Cl2N2O2S and a molecular weight of 345.25 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-(methylaminomethyl)phenyl]benzenesulfonamide.
| Compound Name | 3,4-dichloro-N-[2-(methylaminomethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 43606048 |
| Molecular Formula | C14H14Cl2N2O2S |
| Molecular Weight | 345.25 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | 3,4-dichloro-N-[2-(methylaminomethyl)phenyl]benzenesulfonamide |
| SMILES | CNCc1ccccc1NS(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H14Cl2N2O2S/c1-17-9-10-4-2-3-5-14(10)18-21(19,20)11-6-7-12(15)13(16)8-11/h2-8,17-18H,9H2,1H3 |
| InChIKey | ZJHJKYAOVJAGSK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.25 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |