C13H19N3O2S — CID 43606402
N-(2-amino-4-methylpentyl)-3-cyanobenzenesulfonamide (PubChem CID 43606402) has the molecular formula C13H19N3O2S and a molecular weight of 281.38 g/mol. Its IUPAC name is N-(2-amino-4-methylpentyl)-3-cyanobenzenesulfonamide.
| Compound Name | N-(2-amino-4-methylpentyl)-3-cyanobenzenesulfonamide |
|---|---|
| PubChem CID | 43606402 |
| Molecular Formula | C13H19N3O2S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | N-(2-amino-4-methylpentyl)-3-cyanobenzenesulfonamide |
| SMILES | CC(C)CC(N)CNS(=O)(=O)c1cccc(C#N)c1 |
| InChI | InChI=1S/C13H19N3O2S/c1-10(2)6-12(15)9-16-19(17,18)13-5-3-4-11(7-13)8-14/h3-5,7,10,12,16H,6,9,15H2,1-2H3 |
| InChIKey | NCDVEEUGGPCLTE-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |