C11H21N3O3 — CID 43607361
ethyl N-[2-[methyl(piperidin-4-yl)amino]acetyl]carbamate (PubChem CID 43607361) has the molecular formula C11H21N3O3 and a molecular weight of 243.31 g/mol. Its IUPAC name is ethyl N-[2-[methyl(piperidin-4-yl)amino]acetyl]carbamate.
| Compound Name | ethyl N-[2-[methyl(piperidin-4-yl)amino]acetyl]carbamate |
|---|---|
| PubChem CID | 43607361 |
| Molecular Formula | C11H21N3O3 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | ethyl N-[2-[methyl(piperidin-4-yl)amino]acetyl]carbamate |
| SMILES | CCOC(=O)NC(=O)CN(C)C1CCNCC1 |
| InChI | InChI=1S/C11H21N3O3/c1-3-17-11(16)13-10(15)8-14(2)9-4-6-12-7-5-9/h9,12H,3-8H2,1-2H3,(H,13,15,16) |
| InChIKey | RXGSQKHDMKFVKA-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |