C12H10F5N3 — CID 43607987
2-(1H-imidazol-2-yl)-N-methyl-1-(2,3,4,5,6-pentafluorophenyl)ethanamine (PubChem CID 43607987) has the molecular formula C12H10F5N3 and a molecular weight of 291.22 g/mol. Its IUPAC name is 2-(1H-imidazol-2-yl)-N-methyl-1-(2,3,4,5,6-pentafluorophenyl)ethanamine.
| Compound Name | 2-(1H-imidazol-2-yl)-N-methyl-1-(2,3,4,5,6-pentafluorophenyl)ethanamine |
|---|---|
| PubChem CID | 43607987 |
| Molecular Formula | C12H10F5N3 |
| Molecular Weight | 291.22 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 2-(1H-imidazol-2-yl)-N-methyl-1-(2,3,4,5,6-pentafluorophenyl)ethanamine |
| SMILES | CNC(Cc1ncc[nH]1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H10F5N3/c1-18-5(4-6-19-2-3-20-6)7-8(13)10(15)12(17)11(16)9(7)14/h2-3,5,18H,4H2,1H3,(H,19,20) |
| InChIKey | QMTARDCIEKSNHV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.22 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|