About N-cyclooctyloxan-4-amine
N-cyclooctyloxan-4-amine (PubChem CID 43608383) has the molecular formula C13H25NO
and a molecular weight of 211.35 g/mol. Its IUPAC name is N-cyclooctyloxan-4-amine.
Molecular Properties
| Compound Name | N-cyclooctyloxan-4-amine |
| PubChem CID | 43608383 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | N-cyclooctyloxan-4-amine |
| SMILES | C1CCCC(NC2CCOCC2)CCC1 |
| InChI | InChI=1S/C13H25NO/c1-2-4-6-12(7-5-3-1)14-13-8-10-15-11-9-13/h12-14H,1-11H2 |
| InChIKey | RSRITCOHVBUGEH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-cyclooctyloxan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclooctyloxan-4-amine?
The IUPAC name of N-cyclooctyloxan-4-amine (CID 43608383) is N-cyclooctyloxan-4-amine.
What is the SMILES notation for N-cyclooctyloxan-4-amine?
The canonical SMILES for N-cyclooctyloxan-4-amine is C1CCCC(NC2CCOCC2)CCC1.
What is the InChIKey of N-cyclooctyloxan-4-amine?
The InChIKey is RSRITCOHVBUGEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO/c1-2-4-6-12(7-5-3-1)14-13-8-10-15-11-9-13/h12-14H,1-11H2.
What are the key properties of N-cyclooctyloxan-4-amine?
N-cyclooctyloxan-4-amine has a molecular weight of 211.35 g/mol, XLogP of 2.87, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclooctyloxan-4-amine is sourced from PubChem (CID 43608383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).