About 6,3-Glucuronolactone acetonide
6,3-Glucuronolactone acetonide (PubChem CID 436084) has the molecular formula C9H12O6
and a molecular weight of 216.19 g/mol. Its IUPAC name is 9-hydroxy-4,4-dimethyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one.
Molecular Properties
| Compound Name | 6,3-Glucuronolactone acetonide |
| PubChem CID | 436084 |
| Molecular Formula | C9H12O6 |
| Molecular Weight | 216.19 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 9-hydroxy-4,4-dimethyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one |
| SMILES | CC1(OC2C3C(C(C(=O)O3)O)OC2O1)C |
| InChI | InChI=1S/C9H12O6/c1-9(2)14-6-5-4(13-8(6)15-9)3(10)7(11)12-5/h3-6,8,10H,1-2H3 |
| InChIKey | BDBGJSXZKMTMGP-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 74.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | 314 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.19 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6,3-Glucuronolactone acetonide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,3-Glucuronolactone acetonide?
The IUPAC name of 6,3-Glucuronolactone acetonide (CID 436084) is 9-hydroxy-4,4-dimethyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one.
What is the SMILES notation for 6,3-Glucuronolactone acetonide?
The canonical SMILES for 6,3-Glucuronolactone acetonide is CC1(OC2C3C(C(C(=O)O3)O)OC2O1)C.
What is the InChIKey of 6,3-Glucuronolactone acetonide?
The InChIKey is BDBGJSXZKMTMGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O6/c1-9(2)14-6-5-4(13-8(6)15-9)3(10)7(11)12-5/h3-6,8,10H,1-2H3.
What are the key properties of 6,3-Glucuronolactone acetonide?
6,3-Glucuronolactone acetonide has a molecular weight of 216.19 g/mol, XLogP of -0.50, 0 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6,3-Glucuronolactone acetonide is sourced from PubChem (CID 436084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).