C12H25N3O — CID 43608698
[4-(4-methyl-1,4-diazepan-1-yl)oxan-4-yl]methanamine (PubChem CID 43608698) has the molecular formula C12H25N3O and a molecular weight of 227.35 g/mol. Its IUPAC name is [4-(4-methyl-1,4-diazepan-1-yl)oxan-4-yl]methanamine.
| Compound Name | [4-(4-methyl-1,4-diazepan-1-yl)oxan-4-yl]methanamine |
|---|---|
| PubChem CID | 43608698 |
| Molecular Formula | C12H25N3O |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.20 |
| IUPAC Name | [4-(4-methyl-1,4-diazepan-1-yl)oxan-4-yl]methanamine |
| SMILES | CN1CCCN(C2(CN)CCOCC2)CC1 |
| InChI | InChI=1S/C12H25N3O/c1-14-5-2-6-15(8-7-14)12(11-13)3-9-16-10-4-12/h2-11,13H2,1H3 |
| InChIKey | IKPCNWBNSYLZTH-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |