C11H24N2O — CID 43608807
3-N-butyl-3-N-ethyloxane-3,4-diamine (PubChem CID 43608807) has the molecular formula C11H24N2O and a molecular weight of 200.33 g/mol. Its IUPAC name is 3-N-butyl-3-N-ethyloxane-3,4-diamine.
| Compound Name | 3-N-butyl-3-N-ethyloxane-3,4-diamine |
|---|---|
| PubChem CID | 43608807 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | 3-N-butyl-3-N-ethyloxane-3,4-diamine |
| SMILES | CCCCN(CC)C1COCCC1N |
| InChI | InChI=1S/C11H24N2O/c1-3-5-7-13(4-2)11-9-14-8-6-10(11)12/h10-11H,3-9,12H2,1-2H3 |
| InChIKey | LAXJFXXVSYPUDZ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |