C16H23NO3 — CID 43609831
N-[1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)ethyl]oxan-4-amine (PubChem CID 43609831) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is N-[1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)ethyl]oxan-4-amine.
| Compound Name | N-[1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)ethyl]oxan-4-amine |
|---|---|
| PubChem CID | 43609831 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | N-[1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)ethyl]oxan-4-amine |
| SMILES | CC(NC1CCOCC1)c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C16H23NO3/c1-12(17-14-5-9-18-10-6-14)13-3-4-15-16(11-13)20-8-2-7-19-15/h3-4,11-12,14,17H,2,5-10H2,1H3 |
| InChIKey | NGFUDZTYFROKCL-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |