About CID 43610283
CID 43610283 (PubChem CID 43610283) has the molecular formula C13H23N2O2
and a molecular weight of 239.34 g/mol.
Molecular Properties
| Compound Name | CID 43610283 |
| PubChem CID | 43610283 |
| Molecular Formula | C13H23N2O2 |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.18 |
| IUPAC Name | — |
| SMILES | O=C(CCC1CCC[N]C1)NC1CCOCC1 |
| InChI | InChI=1S/C13H23N2O2/c16-13(15-12-5-8-17-9-6-12)4-3-11-2-1-7-14-10-11/h11-12H,1-10H2,(H,15,16) |
| InChIKey | IYZBQYHLCMKZQN-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 52.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 43610283 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 43610283?
The IUPAC name of CID 43610283 (CID 43610283) is not available.
What is the SMILES notation for CID 43610283?
The canonical SMILES for CID 43610283 is O=C(CCC1CCC[N]C1)NC1CCOCC1.
What is the InChIKey of CID 43610283?
The InChIKey is IYZBQYHLCMKZQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N2O2/c16-13(15-12-5-8-17-9-6-12)4-3-11-2-1-7-14-10-11/h11-12H,1-10H2,(H,15,16).
What are the key properties of CID 43610283?
CID 43610283 has a molecular weight of 239.34 g/mol, XLogP of 1.08, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 43610283 is sourced from PubChem (CID 43610283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).