C13H19ClN2O3S — CID 43610678
3-amino-5-chloro-N,4-dimethyl-N-(oxan-4-yl)benzenesulfonamide (PubChem CID 43610678) has the molecular formula C13H19ClN2O3S and a molecular weight of 318.83 g/mol. Its IUPAC name is 3-amino-5-chloro-N,4-dimethyl-N-(oxan-4-yl)benzenesulfonamide.
| Compound Name | 3-amino-5-chloro-N,4-dimethyl-N-(oxan-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 43610678 |
| Molecular Formula | C13H19ClN2O3S |
| Molecular Weight | 318.83 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 3-amino-5-chloro-N,4-dimethyl-N-(oxan-4-yl)benzenesulfonamide |
| SMILES | Cc1c(N)cc(S(=O)(=O)N(C)C2CCOCC2)cc1Cl |
| InChI | InChI=1S/C13H19ClN2O3S/c1-9-12(14)7-11(8-13(9)15)20(17,18)16(2)10-3-5-19-6-4-10/h7-8,10H,3-6,15H2,1-2H3 |
| InChIKey | ZOTICOSJIPQSTK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.83 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|