About N'-methyl-N'-(oxan-4-yl)ethane-1,2-diamine
N'-methyl-N'-(oxan-4-yl)ethane-1,2-diamine (PubChem CID 43610817) has the molecular formula C8H18N2O
and a molecular weight of 158.24 g/mol. Its IUPAC name is N'-methyl-N'-(oxan-4-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-methyl-N'-(oxan-4-yl)ethane-1,2-diamine |
| PubChem CID | 43610817 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | N'-methyl-N'-(oxan-4-yl)ethane-1,2-diamine |
| SMILES | CN(CCN)C1CCOCC1 |
| InChI | InChI=1S/C8H18N2O/c1-10(5-4-9)8-2-6-11-7-3-8/h8H,2-7,9H2,1H3 |
| InChIKey | IYBLOPIXTVXFFW-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N'-methyl-N'-(oxan-4-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methyl-N'-(oxan-4-yl)ethane-1,2-diamine?
The IUPAC name of N'-methyl-N'-(oxan-4-yl)ethane-1,2-diamine (CID 43610817) is N'-methyl-N'-(oxan-4-yl)ethane-1,2-diamine.
What is the SMILES notation for N'-methyl-N'-(oxan-4-yl)ethane-1,2-diamine?
The canonical SMILES for N'-methyl-N'-(oxan-4-yl)ethane-1,2-diamine is CN(CCN)C1CCOCC1.
What is the InChIKey of N'-methyl-N'-(oxan-4-yl)ethane-1,2-diamine?
The InChIKey is IYBLOPIXTVXFFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O/c1-10(5-4-9)8-2-6-11-7-3-8/h8H,2-7,9H2,1H3.
What are the key properties of N'-methyl-N'-(oxan-4-yl)ethane-1,2-diamine?
N'-methyl-N'-(oxan-4-yl)ethane-1,2-diamine has a molecular weight of 158.24 g/mol, XLogP of 0.06, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methyl-N'-(oxan-4-yl)ethane-1,2-diamine is sourced from PubChem (CID 43610817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).