C15H22N2O3S — CID 43613589
3-ethyl-4-(1,2,3,4-tetrahydroquinolin-6-ylsulfonyl)morpholine (PubChem CID 43613589) has the molecular formula C15H22N2O3S and a molecular weight of 310.42 g/mol. Its IUPAC name is 3-ethyl-4-(1,2,3,4-tetrahydroquinolin-6-ylsulfonyl)morpholine.
| Compound Name | 3-ethyl-4-(1,2,3,4-tetrahydroquinolin-6-ylsulfonyl)morpholine |
|---|---|
| PubChem CID | 43613589 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 3-ethyl-4-(1,2,3,4-tetrahydroquinolin-6-ylsulfonyl)morpholine |
| SMILES | CCC1COCCN1S(=O)(=O)c1ccc2c(c1)CCCN2 |
| InChI | InChI=1S/C15H22N2O3S/c1-2-13-11-20-9-8-17(13)21(18,19)14-5-6-15-12(10-14)4-3-7-16-15/h5-6,10,13,16H,2-4,7-9,11H2,1H3 |
| InChIKey | CXENFNNKJLCJTM-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |