C12H25NO3S — CID 43614802
N-(4-methoxy-4-methylpentan-2-yl)-1,1-dioxothian-4-amine (PubChem CID 43614802) has the molecular formula C12H25NO3S and a molecular weight of 263.40 g/mol. Its IUPAC name is N-(4-methoxy-4-methylpentan-2-yl)-1,1-dioxothian-4-amine.
| Compound Name | N-(4-methoxy-4-methylpentan-2-yl)-1,1-dioxothian-4-amine |
|---|---|
| PubChem CID | 43614802 |
| Molecular Formula | C12H25NO3S |
| Molecular Weight | 263.40 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | N-(4-methoxy-4-methylpentan-2-yl)-1,1-dioxothian-4-amine |
| SMILES | COC(C)(C)CC(C)NC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C12H25NO3S/c1-10(9-12(2,3)16-4)13-11-5-7-17(14,15)8-6-11/h10-11,13H,5-9H2,1-4H3 |
| InChIKey | IANXFWLFJNYMTL-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.40 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |