About 1,1-dioxo-N-(8-tricyclo[5.2.1.02,6]decanyl)thian-4-amine
1,1-dioxo-N-(8-tricyclo[5.2.1.02,6]decanyl)thian-4-amine (PubChem CID 43614945) has the molecular formula C15H25NO2S
and a molecular weight of 283.44 g/mol. Its IUPAC name is 1,1-dioxo-N-(8-tricyclo[5.2.1.02,6]decanyl)thian-4-amine.
Molecular Properties
| Compound Name | 1,1-dioxo-N-(8-tricyclo[5.2.1.02,6]decanyl)thian-4-amine |
| PubChem CID | 43614945 |
| Molecular Formula | C15H25NO2S |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 1,1-dioxo-N-(8-tricyclo[5.2.1.02,6]decanyl)thian-4-amine |
| SMILES | O=S1(=O)CCC(NC2CC3CC2C2CCCC32)CC1 |
| InChI | InChI=1S/C15H25NO2S/c17-19(18)6-4-11(5-7-19)16-15-9-10-8-14(15)13-3-1-2-12(10)13/h10-16H,1-9H2 |
| InChIKey | IPTFQXZQORMBQU-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,1-dioxo-N-(8-tricyclo[5.2.1.02,6]decanyl)thian-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dioxo-N-(8-tricyclo[5.2.1.02,6]decanyl)thian-4-amine?
The IUPAC name of 1,1-dioxo-N-(8-tricyclo[5.2.1.02,6]decanyl)thian-4-amine (CID 43614945) is 1,1-dioxo-N-(8-tricyclo[5.2.1.02,6]decanyl)thian-4-amine.
What is the SMILES notation for 1,1-dioxo-N-(8-tricyclo[5.2.1.02,6]decanyl)thian-4-amine?
The canonical SMILES for 1,1-dioxo-N-(8-tricyclo[5.2.1.02,6]decanyl)thian-4-amine is O=S1(=O)CCC(NC2CC3CC2C2CCCC32)CC1.
What is the InChIKey of 1,1-dioxo-N-(8-tricyclo[5.2.1.02,6]decanyl)thian-4-amine?
The InChIKey is IPTFQXZQORMBQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25NO2S/c17-19(18)6-4-11(5-7-19)16-15-9-10-8-14(15)13-3-1-2-12(10)13/h10-16H,1-9H2.
What are the key properties of 1,1-dioxo-N-(8-tricyclo[5.2.1.02,6]decanyl)thian-4-amine?
1,1-dioxo-N-(8-tricyclo[5.2.1.02,6]decanyl)thian-4-amine has a molecular weight of 283.44 g/mol, XLogP of 1.98, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dioxo-N-(8-tricyclo[5.2.1.02,6]decanyl)thian-4-amine is sourced from PubChem (CID 43614945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).