About 1-[[(1,1-dioxothian-4-yl)amino]methyl]naphthalen-2-ol
1-[[(1,1-dioxothian-4-yl)amino]methyl]naphthalen-2-ol (PubChem CID 43615080) has the molecular formula C16H19NO3S
and a molecular weight of 305.40 g/mol. Its IUPAC name is 1-[[(1,1-dioxothian-4-yl)amino]methyl]naphthalen-2-ol.
Molecular Properties
| Compound Name | 1-[[(1,1-dioxothian-4-yl)amino]methyl]naphthalen-2-ol |
| PubChem CID | 43615080 |
| Molecular Formula | C16H19NO3S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 1-[[(1,1-dioxothian-4-yl)amino]methyl]naphthalen-2-ol |
| SMILES | O=S1(=O)CCC(NCc2c(O)ccc3ccccc23)CC1 |
| InChI | InChI=1S/C16H19NO3S/c18-16-6-5-12-3-1-2-4-14(12)15(16)11-17-13-7-9-21(19,20)10-8-13/h1-6,13,17-18H,7-11H2 |
| InChIKey | ZGNBMMBXGGGBFV-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 1-[[(1,1-dioxothian-4-yl)amino]methyl]naphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(1,1-dioxothian-4-yl)amino]methyl]naphthalen-2-ol?
The IUPAC name of 1-[[(1,1-dioxothian-4-yl)amino]methyl]naphthalen-2-ol (CID 43615080) is 1-[[(1,1-dioxothian-4-yl)amino]methyl]naphthalen-2-ol.
What is the SMILES notation for 1-[[(1,1-dioxothian-4-yl)amino]methyl]naphthalen-2-ol?
The canonical SMILES for 1-[[(1,1-dioxothian-4-yl)amino]methyl]naphthalen-2-ol is O=S1(=O)CCC(NCc2c(O)ccc3ccccc23)CC1.
What is the InChIKey of 1-[[(1,1-dioxothian-4-yl)amino]methyl]naphthalen-2-ol?
The InChIKey is ZGNBMMBXGGGBFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO3S/c18-16-6-5-12-3-1-2-4-14(12)15(16)11-17-13-7-9-21(19,20)10-8-13/h1-6,13,17-18H,7-11H2.
What are the key properties of 1-[[(1,1-dioxothian-4-yl)amino]methyl]naphthalen-2-ol?
1-[[(1,1-dioxothian-4-yl)amino]methyl]naphthalen-2-ol has a molecular weight of 305.40 g/mol, XLogP of 2.21, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(1,1-dioxothian-4-yl)amino]methyl]naphthalen-2-ol is sourced from PubChem (CID 43615080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).