About 1-(1,1-dioxothian-4-yl)piperidin-4-amine
1-(1,1-dioxothian-4-yl)piperidin-4-amine (PubChem CID 43615336) has the molecular formula C10H20N2O2S
and a molecular weight of 232.35 g/mol. Its IUPAC name is 1-(1,1-dioxothian-4-yl)piperidin-4-amine.
Molecular Properties
| Compound Name | 1-(1,1-dioxothian-4-yl)piperidin-4-amine |
| PubChem CID | 43615336 |
| Molecular Formula | C10H20N2O2S |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 1-(1,1-dioxothian-4-yl)piperidin-4-amine |
| SMILES | NC1CCN(C2CCS(=O)(=O)CC2)CC1 |
| InChI | InChI=1S/C10H20N2O2S/c11-9-1-5-12(6-2-9)10-3-7-15(13,14)8-4-10/h9-10H,1-8,11H2 |
| InChIKey | RLWFEECPMXQTJR-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(1,1-dioxothian-4-yl)piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,1-dioxothian-4-yl)piperidin-4-amine?
The IUPAC name of 1-(1,1-dioxothian-4-yl)piperidin-4-amine (CID 43615336) is 1-(1,1-dioxothian-4-yl)piperidin-4-amine.
What is the SMILES notation for 1-(1,1-dioxothian-4-yl)piperidin-4-amine?
The canonical SMILES for 1-(1,1-dioxothian-4-yl)piperidin-4-amine is NC1CCN(C2CCS(=O)(=O)CC2)CC1.
What is the InChIKey of 1-(1,1-dioxothian-4-yl)piperidin-4-amine?
The InChIKey is RLWFEECPMXQTJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O2S/c11-9-1-5-12(6-2-9)10-3-7-15(13,14)8-4-10/h9-10H,1-8,11H2.
What are the key properties of 1-(1,1-dioxothian-4-yl)piperidin-4-amine?
1-(1,1-dioxothian-4-yl)piperidin-4-amine has a molecular weight of 232.35 g/mol, XLogP of -0.01, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,1-dioxothian-4-yl)piperidin-4-amine is sourced from PubChem (CID 43615336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).