1-(2-butylsulfanylethyl)triazole-4-carboxylic acid

C9H15N3O2S — CID 43615597

IUPAC1-(2-butylsulfanylethyl)triazole-4-carboxylic acid
SMILESCCCCSCCn1cc(C(=O)O)nn1
InChIInChI=1S/C9H15N3O2S/c1-2-3-5-15-6-4-12-7-8(9(13)14)10-11-12/h7H,2-6H2,1H3,(H,13,14)
InChIKeyJLHZUROJTILQKR-UHFFFAOYSA-N
MW229.30 g/mol
LogP1.51
Rot. Bonds7

About 1-(2-butylsulfanylethyl)triazole-4-carboxylic acid

1-(2-butylsulfanylethyl)triazole-4-carboxylic acid (PubChem CID 43615597) has the molecular formula C9H15N3O2S and a molecular weight of 229.30 g/mol. Its IUPAC name is 1-(2-butylsulfanylethyl)triazole-4-carboxylic acid.

Molecular Properties

Compound Name1-(2-butylsulfanylethyl)triazole-4-carboxylic acid
PubChem CID43615597
Molecular FormulaC9H15N3O2S
Molecular Weight229.30 g/mol
Exact Mass229.09
IUPAC Name1-(2-butylsulfanylethyl)triazole-4-carboxylic acid
SMILESCCCCSCCn1cc(C(=O)O)nn1
InChIInChI=1S/C9H15N3O2S/c1-2-3-5-15-6-4-12-7-8(9(13)14)10-11-12/h7H,2-6H2,1H3,(H,13,14)
InChIKeyJLHZUROJTILQKR-UHFFFAOYSA-N
XLogP1.51
TPSA68.01 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500229.30
LogP ≤ 51.51
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 1-(2-butylsulfanylethyl)triazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(2-butylsulfanylethyl)triazole-4-carboxylic acid?
The IUPAC name of 1-(2-butylsulfanylethyl)triazole-4-carboxylic acid (CID 43615597) is 1-(2-butylsulfanylethyl)triazole-4-carboxylic acid.
What is the SMILES notation for 1-(2-butylsulfanylethyl)triazole-4-carboxylic acid?
The canonical SMILES for 1-(2-butylsulfanylethyl)triazole-4-carboxylic acid is CCCCSCCn1cc(C(=O)O)nn1.
What is the InChIKey of 1-(2-butylsulfanylethyl)triazole-4-carboxylic acid?
The InChIKey is JLHZUROJTILQKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O2S/c1-2-3-5-15-6-4-12-7-8(9(13)14)10-11-12/h7H,2-6H2,1H3,(H,13,14).
What are the key properties of 1-(2-butylsulfanylethyl)triazole-4-carboxylic acid?
1-(2-butylsulfanylethyl)triazole-4-carboxylic acid has a molecular weight of 229.30 g/mol, XLogP of 1.51, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-butylsulfanylethyl)triazole-4-carboxylic acid is sourced from PubChem (CID 43615597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).