About 2,2,2-trifluoroethyl N-pyrazin-2-ylcarbamate
2,2,2-trifluoroethyl N-pyrazin-2-ylcarbamate (PubChem CID 43616223) has the molecular formula C7H6F3N3O2
and a molecular weight of 221.14 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-pyrazin-2-ylcarbamate.
Molecular Properties
| Compound Name | 2,2,2-trifluoroethyl N-pyrazin-2-ylcarbamate |
| PubChem CID | 43616223 |
| Molecular Formula | C7H6F3N3O2 |
| Molecular Weight | 221.14 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | 2,2,2-trifluoroethyl N-pyrazin-2-ylcarbamate |
| SMILES | O=C(Nc1cnccn1)OCC(F)(F)F |
| InChI | InChI=1S/C7H6F3N3O2/c8-7(9,10)4-15-6(14)13-5-3-11-1-2-12-5/h1-3H,4H2,(H,12,13,14) |
| InChIKey | WMSBQQSWSDAPHV-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.14 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,2,2-trifluoroethyl N-pyrazin-2-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trifluoroethyl N-pyrazin-2-ylcarbamate?
The IUPAC name of 2,2,2-trifluoroethyl N-pyrazin-2-ylcarbamate (CID 43616223) is 2,2,2-trifluoroethyl N-pyrazin-2-ylcarbamate.
What is the SMILES notation for 2,2,2-trifluoroethyl N-pyrazin-2-ylcarbamate?
The canonical SMILES for 2,2,2-trifluoroethyl N-pyrazin-2-ylcarbamate is O=C(Nc1cnccn1)OCC(F)(F)F.
What is the InChIKey of 2,2,2-trifluoroethyl N-pyrazin-2-ylcarbamate?
The InChIKey is WMSBQQSWSDAPHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F3N3O2/c8-7(9,10)4-15-6(14)13-5-3-11-1-2-12-5/h1-3H,4H2,(H,12,13,14).
What are the key properties of 2,2,2-trifluoroethyl N-pyrazin-2-ylcarbamate?
2,2,2-trifluoroethyl N-pyrazin-2-ylcarbamate has a molecular weight of 221.14 g/mol, XLogP of 1.59, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trifluoroethyl N-pyrazin-2-ylcarbamate is sourced from PubChem (CID 43616223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).