About 4-N,4-N-dimethyl-1-N-(oxan-4-yl)benzene-1,4-diamine
4-N,4-N-dimethyl-1-N-(oxan-4-yl)benzene-1,4-diamine (PubChem CID 43616833) has the molecular formula C13H20N2O
and a molecular weight of 220.32 g/mol. Its IUPAC name is 4-N,4-N-dimethyl-1-N-(oxan-4-yl)benzene-1,4-diamine.
Molecular Properties
| Compound Name | 4-N,4-N-dimethyl-1-N-(oxan-4-yl)benzene-1,4-diamine |
| PubChem CID | 43616833 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 4-N,4-N-dimethyl-1-N-(oxan-4-yl)benzene-1,4-diamine |
| SMILES | CN(C)c1ccc(NC2CCOCC2)cc1 |
| InChI | InChI=1S/C13H20N2O/c1-15(2)13-5-3-11(4-6-13)14-12-7-9-16-10-8-12/h3-6,12,14H,7-10H2,1-2H3 |
| InChIKey | JYASRBRSTBKZHH-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze 4-N,4-N-dimethyl-1-N-(oxan-4-yl)benzene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N,4-N-dimethyl-1-N-(oxan-4-yl)benzene-1,4-diamine?
The IUPAC name of 4-N,4-N-dimethyl-1-N-(oxan-4-yl)benzene-1,4-diamine (CID 43616833) is 4-N,4-N-dimethyl-1-N-(oxan-4-yl)benzene-1,4-diamine.
What is the SMILES notation for 4-N,4-N-dimethyl-1-N-(oxan-4-yl)benzene-1,4-diamine?
The canonical SMILES for 4-N,4-N-dimethyl-1-N-(oxan-4-yl)benzene-1,4-diamine is CN(C)c1ccc(NC2CCOCC2)cc1.
What is the InChIKey of 4-N,4-N-dimethyl-1-N-(oxan-4-yl)benzene-1,4-diamine?
The InChIKey is JYASRBRSTBKZHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O/c1-15(2)13-5-3-11(4-6-13)14-12-7-9-16-10-8-12/h3-6,12,14H,7-10H2,1-2H3.
What are the key properties of 4-N,4-N-dimethyl-1-N-(oxan-4-yl)benzene-1,4-diamine?
4-N,4-N-dimethyl-1-N-(oxan-4-yl)benzene-1,4-diamine has a molecular weight of 220.32 g/mol, XLogP of 2.34, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N,4-N-dimethyl-1-N-(oxan-4-yl)benzene-1,4-diamine is sourced from PubChem (CID 43616833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).