C14H16N4S — CID 43617135
2-[4-(dimethylamino)anilino]pyridine-4-carbothioamide (PubChem CID 43617135) has the molecular formula C14H16N4S and a molecular weight of 272.38 g/mol. Its IUPAC name is 2-[4-(dimethylamino)anilino]pyridine-4-carbothioamide.
| Compound Name | 2-[4-(dimethylamino)anilino]pyridine-4-carbothioamide |
|---|---|
| PubChem CID | 43617135 |
| Molecular Formula | C14H16N4S |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 2-[4-(dimethylamino)anilino]pyridine-4-carbothioamide |
| SMILES | CN(C)c1ccc(Nc2cc(C(N)=S)ccn2)cc1 |
| InChI | InChI=1S/C14H16N4S/c1-18(2)12-5-3-11(4-6-12)17-13-9-10(14(15)19)7-8-16-13/h3-9H,1-2H3,(H2,15,19)(H,16,17) |
| InChIKey | NYZJYTBOSRDROJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|