C9H16O6S — CID 43617846
2-(3-methoxy-3-oxopropyl)sulfonyl-3-methylbutanoic acid (PubChem CID 43617846) has the molecular formula C9H16O6S and a molecular weight of 252.29 g/mol. Its IUPAC name is 2-(3-methoxy-3-oxopropyl)sulfonyl-3-methylbutanoic acid.
| Compound Name | 2-(3-methoxy-3-oxopropyl)sulfonyl-3-methylbutanoic acid |
|---|---|
| PubChem CID | 43617846 |
| Molecular Formula | C9H16O6S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 2-(3-methoxy-3-oxopropyl)sulfonyl-3-methylbutanoic acid |
| SMILES | COC(=O)CCS(=O)(=O)C(C(=O)O)C(C)C |
| InChI | InChI=1S/C9H16O6S/c1-6(2)8(9(11)12)16(13,14)5-4-7(10)15-3/h6,8H,4-5H2,1-3H3,(H,11,12) |
| InChIKey | YMPASRYEACXTNJ-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |