C12H15ClN2O5S — CID 43618134
methyl 2-[1-(4-amino-2-chloroanilino)-1-oxopropan-2-yl]sulfonylacetate (PubChem CID 43618134) has the molecular formula C12H15ClN2O5S and a molecular weight of 334.78 g/mol. Its IUPAC name is methyl 2-[1-(4-amino-2-chloroanilino)-1-oxopropan-2-yl]sulfonylacetate.
| Compound Name | methyl 2-[1-(4-amino-2-chloroanilino)-1-oxopropan-2-yl]sulfonylacetate |
|---|---|
| PubChem CID | 43618134 |
| Molecular Formula | C12H15ClN2O5S |
| Molecular Weight | 334.78 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | methyl 2-[1-(4-amino-2-chloroanilino)-1-oxopropan-2-yl]sulfonylacetate |
| SMILES | COC(=O)CS(=O)(=O)C(C)C(=O)Nc1ccc(N)cc1Cl |
| InChI | InChI=1S/C12H15ClN2O5S/c1-7(21(18,19)6-11(16)20-2)12(17)15-10-4-3-8(14)5-9(10)13/h3-5,7H,6,14H2,1-2H3,(H,15,17) |
| InChIKey | ICPKBTNFQHRNCT-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.78 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|