C15H18FNO3 — CID 43618637
2-[[(E)-3-(4-fluorophenyl)prop-2-enoyl]amino]-2-methylpentanoic acid (PubChem CID 43618637) has the molecular formula C15H18FNO3 and a molecular weight of 279.31 g/mol. Its IUPAC name is 2-[[(E)-3-(4-fluorophenyl)prop-2-enoyl]amino]-2-methylpentanoic acid.
| Compound Name | 2-[[(E)-3-(4-fluorophenyl)prop-2-enoyl]amino]-2-methylpentanoic acid |
|---|---|
| PubChem CID | 43618637 |
| Molecular Formula | C15H18FNO3 |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 2-[[(E)-3-(4-fluorophenyl)prop-2-enoyl]amino]-2-methylpentanoic acid |
| SMILES | CCCC(C)(NC(=O)/C=C/c1ccc(F)cc1)C(=O)O |
| InChI | InChI=1S/C15H18FNO3/c1-3-10-15(2,14(19)20)17-13(18)9-6-11-4-7-12(16)8-5-11/h4-9H,3,10H2,1-2H3,(H,17,18)(H,19,20)/b9-6+ |
| InChIKey | LJYFICIFHPBEBQ-RMKNXTFCSA-N |
| XLogP | 2.60 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|