About 2-[(1,5-dimethylpyrrole-2-carbonyl)amino]-2-methylpentanoic acid
2-[(1,5-dimethylpyrrole-2-carbonyl)amino]-2-methylpentanoic acid (PubChem CID 43619096) has the molecular formula C13H20N2O3
and a molecular weight of 252.31 g/mol. Its IUPAC name is 2-[(1,5-dimethylpyrrole-2-carbonyl)amino]-2-methylpentanoic acid.
Molecular Properties
| Compound Name | 2-[(1,5-dimethylpyrrole-2-carbonyl)amino]-2-methylpentanoic acid |
| PubChem CID | 43619096 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 2-[(1,5-dimethylpyrrole-2-carbonyl)amino]-2-methylpentanoic acid |
| SMILES | CCCC(C)(NC(=O)c1ccc(C)n1C)C(=O)O |
| InChI | InChI=1S/C13H20N2O3/c1-5-8-13(3,12(17)18)14-11(16)10-7-6-9(2)15(10)4/h6-7H,5,8H2,1-4H3,(H,14,16)(H,17,18) |
| InChIKey | APKFNPMEMIBSDT-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(1,5-dimethylpyrrole-2-carbonyl)amino]-2-methylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1,5-dimethylpyrrole-2-carbonyl)amino]-2-methylpentanoic acid?
The IUPAC name of 2-[(1,5-dimethylpyrrole-2-carbonyl)amino]-2-methylpentanoic acid (CID 43619096) is 2-[(1,5-dimethylpyrrole-2-carbonyl)amino]-2-methylpentanoic acid.
What is the SMILES notation for 2-[(1,5-dimethylpyrrole-2-carbonyl)amino]-2-methylpentanoic acid?
The canonical SMILES for 2-[(1,5-dimethylpyrrole-2-carbonyl)amino]-2-methylpentanoic acid is CCCC(C)(NC(=O)c1ccc(C)n1C)C(=O)O.
What is the InChIKey of 2-[(1,5-dimethylpyrrole-2-carbonyl)amino]-2-methylpentanoic acid?
The InChIKey is APKFNPMEMIBSDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O3/c1-5-8-13(3,12(17)18)14-11(16)10-7-6-9(2)15(10)4/h6-7H,5,8H2,1-4H3,(H,14,16)(H,17,18).
What are the key properties of 2-[(1,5-dimethylpyrrole-2-carbonyl)amino]-2-methylpentanoic acid?
2-[(1,5-dimethylpyrrole-2-carbonyl)amino]-2-methylpentanoic acid has a molecular weight of 252.31 g/mol, XLogP of 1.71, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1,5-dimethylpyrrole-2-carbonyl)amino]-2-methylpentanoic acid is sourced from PubChem (CID 43619096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).