C11H22N2O3 — CID 43619164
2-(butylcarbamoylamino)-2-methylpentanoic acid (PubChem CID 43619164) has the molecular formula C11H22N2O3 and a molecular weight of 230.31 g/mol. Its IUPAC name is 2-(butylcarbamoylamino)-2-methylpentanoic acid.
| Compound Name | 2-(butylcarbamoylamino)-2-methylpentanoic acid |
|---|---|
| PubChem CID | 43619164 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | 2-(butylcarbamoylamino)-2-methylpentanoic acid |
| SMILES | CCCCNC(=O)NC(C)(CCC)C(=O)O |
| InChI | InChI=1S/C11H22N2O3/c1-4-6-8-12-10(16)13-11(3,7-5-2)9(14)15/h4-8H2,1-3H3,(H,14,15)(H2,12,13,16) |
| InChIKey | AZNXIFBOCZEOFR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|