2-methyl-2-(2,2,2-trifluoroethylamino)pentanoic acid

C8H14F3NO2 — CID 43619540

IUPAC2-methyl-2-(2,2,2-trifluoroethylamino)pentanoic acid
SMILESCCCC(C)(NCC(F)(F)F)C(=O)O
InChIInChI=1S/C8H14F3NO2/c1-3-4-7(2,6(13)14)12-5-8(9,10)11/h12H,3-5H2,1-2H3,(H,13,14)
InChIKeyFSVPCLQOPCNKOB-UHFFFAOYSA-N
MW213.20 g/mol
LogP1.78
Rot. Bonds5

About 2-methyl-2-(2,2,2-trifluoroethylamino)pentanoic acid

2-methyl-2-(2,2,2-trifluoroethylamino)pentanoic acid (PubChem CID 43619540) has the molecular formula C8H14F3NO2 and a molecular weight of 213.20 g/mol. Its IUPAC name is 2-methyl-2-(2,2,2-trifluoroethylamino)pentanoic acid.

Molecular Properties

Compound Name2-methyl-2-(2,2,2-trifluoroethylamino)pentanoic acid
PubChem CID43619540
Molecular FormulaC8H14F3NO2
Molecular Weight213.20 g/mol
Exact Mass213.10
IUPAC Name2-methyl-2-(2,2,2-trifluoroethylamino)pentanoic acid
SMILESCCCC(C)(NCC(F)(F)F)C(=O)O
InChIInChI=1S/C8H14F3NO2/c1-3-4-7(2,6(13)14)12-5-8(9,10)11/h12H,3-5H2,1-2H3,(H,13,14)
InChIKeyFSVPCLQOPCNKOB-UHFFFAOYSA-N
XLogP1.78
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500213.20
LogP ≤ 51.78
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-methyl-2-(2,2,2-trifluoroethylamino)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methyl-2-(2,2,2-trifluoroethylamino)pentanoic acid?
The IUPAC name of 2-methyl-2-(2,2,2-trifluoroethylamino)pentanoic acid (CID 43619540) is 2-methyl-2-(2,2,2-trifluoroethylamino)pentanoic acid.
What is the SMILES notation for 2-methyl-2-(2,2,2-trifluoroethylamino)pentanoic acid?
The canonical SMILES for 2-methyl-2-(2,2,2-trifluoroethylamino)pentanoic acid is CCCC(C)(NCC(F)(F)F)C(=O)O.
What is the InChIKey of 2-methyl-2-(2,2,2-trifluoroethylamino)pentanoic acid?
The InChIKey is FSVPCLQOPCNKOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F3NO2/c1-3-4-7(2,6(13)14)12-5-8(9,10)11/h12H,3-5H2,1-2H3,(H,13,14).
What are the key properties of 2-methyl-2-(2,2,2-trifluoroethylamino)pentanoic acid?
2-methyl-2-(2,2,2-trifluoroethylamino)pentanoic acid has a molecular weight of 213.20 g/mol, XLogP of 1.78, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-(2,2,2-trifluoroethylamino)pentanoic acid is sourced from PubChem (CID 43619540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).