C12H16FN3O3S — CID 43619956
N-(2-amino-4-fluorophenyl)-3-(1,1-dioxo-1,2-thiazolidin-2-yl)propanamide (PubChem CID 43619956) has the molecular formula C12H16FN3O3S and a molecular weight of 301.34 g/mol. Its IUPAC name is N-(2-amino-4-fluorophenyl)-3-(1,1-dioxo-1,2-thiazolidin-2-yl)propanamide.
| Compound Name | N-(2-amino-4-fluorophenyl)-3-(1,1-dioxo-1,2-thiazolidin-2-yl)propanamide |
|---|---|
| PubChem CID | 43619956 |
| Molecular Formula | C12H16FN3O3S |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | N-(2-amino-4-fluorophenyl)-3-(1,1-dioxo-1,2-thiazolidin-2-yl)propanamide |
| SMILES | Nc1cc(F)ccc1NC(=O)CCN1CCCS1(=O)=O |
| InChI | InChI=1S/C12H16FN3O3S/c13-9-2-3-11(10(14)8-9)15-12(17)4-6-16-5-1-7-20(16,18)19/h2-3,8H,1,4-7,14H2,(H,15,17) |
| InChIKey | BDEVFFTWYRMBAG-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|