C19H36N2 — CID 43620259
[1-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-3,3,5-trimethylcyclohexyl]methanamine (PubChem CID 43620259) has the molecular formula C19H36N2 and a molecular weight of 292.51 g/mol. Its IUPAC name is [1-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-3,3,5-trimethylcyclohexyl]methanamine.
| Compound Name | [1-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-3,3,5-trimethylcyclohexyl]methanamine |
|---|---|
| PubChem CID | 43620259 |
| Molecular Formula | C19H36N2 |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.29 |
| IUPAC Name | [1-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-3,3,5-trimethylcyclohexyl]methanamine |
| SMILES | CC1CC(C)(C)CC(CN)(N2CCC3CCCCC3C2)C1 |
| InChI | InChI=1S/C19H36N2/c1-15-10-18(2,3)13-19(11-15,14-20)21-9-8-16-6-4-5-7-17(16)12-21/h15-17H,4-14,20H2,1-3H3 |
| InChIKey | DLFALCLXGCRACS-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |