C17H25FN2 — CID 43620568
1-[2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-5-fluorophenyl]-N-methylmethanamine (PubChem CID 43620568) has the molecular formula C17H25FN2 and a molecular weight of 276.40 g/mol. Its IUPAC name is 1-[2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-5-fluorophenyl]-N-methylmethanamine.
| Compound Name | 1-[2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-5-fluorophenyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 43620568 |
| Molecular Formula | C17H25FN2 |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 1-[2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-5-fluorophenyl]-N-methylmethanamine |
| SMILES | CNCc1cc(F)ccc1N1CCC2CCCCC2C1 |
| InChI | InChI=1S/C17H25FN2/c1-19-11-15-10-16(18)6-7-17(15)20-9-8-13-4-2-3-5-14(13)12-20/h6-7,10,13-14,19H,2-5,8-9,11-12H2,1H3 |
| InChIKey | HHRVECNKKIYATI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |