C15H26N2O3 — CID 43620611
4-[3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonyl(methyl)amino]butanoic acid (PubChem CID 43620611) has the molecular formula C15H26N2O3 and a molecular weight of 282.38 g/mol. Its IUPAC name is 4-[3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonyl(methyl)amino]butanoic acid.
| Compound Name | 4-[3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonyl(methyl)amino]butanoic acid |
|---|---|
| PubChem CID | 43620611 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | 4-[3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonyl(methyl)amino]butanoic acid |
| SMILES | CN(CCCC(=O)O)C(=O)N1CCC2CCCCC2C1 |
| InChI | InChI=1S/C15H26N2O3/c1-16(9-4-7-14(18)19)15(20)17-10-8-12-5-2-3-6-13(12)11-17/h12-13H,2-11H2,1H3,(H,18,19) |
| InChIKey | VROHOOJJTDEJST-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |