C12H19ClN2O2 — CID 43620620
N-(2-chloroacetyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carboxamide (PubChem CID 43620620) has the molecular formula C12H19ClN2O2 and a molecular weight of 258.75 g/mol. Its IUPAC name is N-(2-chloroacetyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carboxamide.
| Compound Name | N-(2-chloroacetyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 43620620 |
| Molecular Formula | C12H19ClN2O2 |
| Molecular Weight | 258.75 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | N-(2-chloroacetyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carboxamide |
| SMILES | O=C(CCl)NC(=O)N1CCC2CCCCC2C1 |
| InChI | InChI=1S/C12H19ClN2O2/c13-7-11(16)14-12(17)15-6-5-9-3-1-2-4-10(9)8-15/h9-10H,1-8H2,(H,14,16,17) |
| InChIKey | HLUOIVINRCAGCH-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.75 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|