About 6-bromoquinoline-3,4-diamine
6-bromoquinoline-3,4-diamine (PubChem CID 43621282) has the molecular formula C9H8BrN3
and a molecular weight of 238.09 g/mol. Its IUPAC name is 6-bromoquinoline-3,4-diamine.
Molecular Properties
| Compound Name | 6-bromoquinoline-3,4-diamine |
| PubChem CID | 43621282 |
| Molecular Formula | C9H8BrN3 |
| Molecular Weight | 238.09 g/mol |
| Exact Mass | 236.99 |
| IUPAC Name | 6-bromoquinoline-3,4-diamine |
| SMILES | Nc1cnc2ccc(Br)cc2c1N |
| InChI | InChI=1S/C9H8BrN3/c10-5-1-2-8-6(3-5)9(12)7(11)4-13-8/h1-4H,11H2,(H2,12,13) |
| InChIKey | VSUQNFQMMYNTSK-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.09 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-bromoquinoline-3,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromoquinoline-3,4-diamine?
The IUPAC name of 6-bromoquinoline-3,4-diamine (CID 43621282) is 6-bromoquinoline-3,4-diamine.
What is the SMILES notation for 6-bromoquinoline-3,4-diamine?
The canonical SMILES for 6-bromoquinoline-3,4-diamine is Nc1cnc2ccc(Br)cc2c1N.
What is the InChIKey of 6-bromoquinoline-3,4-diamine?
The InChIKey is VSUQNFQMMYNTSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrN3/c10-5-1-2-8-6(3-5)9(12)7(11)4-13-8/h1-4H,11H2,(H2,12,13).
What are the key properties of 6-bromoquinoline-3,4-diamine?
6-bromoquinoline-3,4-diamine has a molecular weight of 238.09 g/mol, XLogP of 2.16, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromoquinoline-3,4-diamine is sourced from PubChem (CID 43621282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).