About N-(2,4,6-trichlorophenyl)adamantan-2-amine
N-(2,4,6-trichlorophenyl)adamantan-2-amine (PubChem CID 43621697) has the molecular formula C16H18Cl3N
and a molecular weight of 330.69 g/mol. Its IUPAC name is N-(2,4,6-trichlorophenyl)adamantan-2-amine.
Molecular Properties
| Compound Name | N-(2,4,6-trichlorophenyl)adamantan-2-amine |
| PubChem CID | 43621697 |
| Molecular Formula | C16H18Cl3N |
| Molecular Weight | 330.69 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | N-(2,4,6-trichlorophenyl)adamantan-2-amine |
| SMILES | Clc1cc(Cl)c(NC2C3CC4CC(C3)CC2C4)c(Cl)c1 |
| InChI | InChI=1S/C16H18Cl3N/c17-12-6-13(18)16(14(19)7-12)20-15-10-2-8-1-9(4-10)5-11(15)3-8/h6-11,15,20H,1-5H2 |
| InChIKey | HRLCSORPBCCWJB-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 330.69 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(2,4,6-trichlorophenyl)adamantan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,4,6-trichlorophenyl)adamantan-2-amine?
The IUPAC name of N-(2,4,6-trichlorophenyl)adamantan-2-amine (CID 43621697) is N-(2,4,6-trichlorophenyl)adamantan-2-amine.
What is the SMILES notation for N-(2,4,6-trichlorophenyl)adamantan-2-amine?
The canonical SMILES for N-(2,4,6-trichlorophenyl)adamantan-2-amine is Clc1cc(Cl)c(NC2C3CC4CC(C3)CC2C4)c(Cl)c1.
What is the InChIKey of N-(2,4,6-trichlorophenyl)adamantan-2-amine?
The InChIKey is HRLCSORPBCCWJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18Cl3N/c17-12-6-13(18)16(14(19)7-12)20-15-10-2-8-1-9(4-10)5-11(15)3-8/h6-11,15,20H,1-5H2.
What are the key properties of N-(2,4,6-trichlorophenyl)adamantan-2-amine?
N-(2,4,6-trichlorophenyl)adamantan-2-amine has a molecular weight of 330.69 g/mol, XLogP of 5.88, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,4,6-trichlorophenyl)adamantan-2-amine is sourced from PubChem (CID 43621697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).