C10H8BrF3O4 — CID 43622512
3-bromo-5-methoxy-4-(2,2,2-trifluoroethoxy)benzoic acid (PubChem CID 43622512) has the molecular formula C10H8BrF3O4 and a molecular weight of 329.07 g/mol. Its IUPAC name is 3-bromo-5-methoxy-4-(2,2,2-trifluoroethoxy)benzoic acid.
| Compound Name | 3-bromo-5-methoxy-4-(2,2,2-trifluoroethoxy)benzoic acid |
|---|---|
| PubChem CID | 43622512 |
| Molecular Formula | C10H8BrF3O4 |
| Molecular Weight | 329.07 g/mol |
| Exact Mass | 327.96 |
| IUPAC Name | 3-bromo-5-methoxy-4-(2,2,2-trifluoroethoxy)benzoic acid |
| SMILES | COc1cc(C(=O)O)cc(Br)c1OCC(F)(F)F |
| InChI | InChI=1S/C10H8BrF3O4/c1-17-7-3-5(9(15)16)2-6(11)8(7)18-4-10(12,13)14/h2-3H,4H2,1H3,(H,15,16) |
| InChIKey | ZYWKTYGDMDXVNB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.07 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |