C9H10BrNO4S — CID 43623494
methyl 2-[(5-bromothiophene-3-carbonyl)amino]-3-hydroxypropanoate (PubChem CID 43623494) has the molecular formula C9H10BrNO4S and a molecular weight of 308.15 g/mol. Its IUPAC name is methyl 2-[(5-bromothiophene-3-carbonyl)amino]-3-hydroxypropanoate.
| Compound Name | methyl 2-[(5-bromothiophene-3-carbonyl)amino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 43623494 |
| Molecular Formula | C9H10BrNO4S |
| Molecular Weight | 308.15 g/mol |
| Exact Mass | 306.95 |
| IUPAC Name | methyl 2-[(5-bromothiophene-3-carbonyl)amino]-3-hydroxypropanoate |
| SMILES | COC(=O)C(CO)NC(=O)c1csc(Br)c1 |
| InChI | InChI=1S/C9H10BrNO4S/c1-15-9(14)6(3-12)11-8(13)5-2-7(10)16-4-5/h2,4,6,12H,3H2,1H3,(H,11,13) |
| InChIKey | QNUHADPWPQETKM-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.15 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |