C13H18N4O4 — CID 43623563
methyl 3-hydroxy-2-[(1-pyrimidin-2-ylpyrrolidine-2-carbonyl)amino]propanoate (PubChem CID 43623563) has the molecular formula C13H18N4O4 and a molecular weight of 294.31 g/mol. Its IUPAC name is methyl 3-hydroxy-2-[(1-pyrimidin-2-ylpyrrolidine-2-carbonyl)amino]propanoate.
| Compound Name | methyl 3-hydroxy-2-[(1-pyrimidin-2-ylpyrrolidine-2-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 43623563 |
| Molecular Formula | C13H18N4O4 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | methyl 3-hydroxy-2-[(1-pyrimidin-2-ylpyrrolidine-2-carbonyl)amino]propanoate |
| SMILES | COC(=O)C(CO)NC(=O)C1CCCN1c1ncccn1 |
| InChI | InChI=1S/C13H18N4O4/c1-21-12(20)9(8-18)16-11(19)10-4-2-7-17(10)13-14-5-3-6-15-13/h3,5-6,9-10,18H,2,4,7-8H2,1H3,(H,16,19) |
| InChIKey | UFLHUQHTLGHDOB-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |