C15H20BrNO3 — CID 43623852
ethyl 3-bromo-4-(3,3-dimethylbutanoylamino)benzoate (PubChem CID 43623852) has the molecular formula C15H20BrNO3 and a molecular weight of 342.23 g/mol. Its IUPAC name is ethyl 3-bromo-4-(3,3-dimethylbutanoylamino)benzoate.
| Compound Name | ethyl 3-bromo-4-(3,3-dimethylbutanoylamino)benzoate |
|---|---|
| PubChem CID | 43623852 |
| Molecular Formula | C15H20BrNO3 |
| Molecular Weight | 342.23 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | ethyl 3-bromo-4-(3,3-dimethylbutanoylamino)benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CC(C)(C)C)c(Br)c1 |
| InChI | InChI=1S/C15H20BrNO3/c1-5-20-14(19)10-6-7-12(11(16)8-10)17-13(18)9-15(2,3)4/h6-8H,5,9H2,1-4H3,(H,17,18) |
| InChIKey | FFNOAPBLHOYNKC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.23 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |