C10H17N3O4S — CID 43624162
methyl 3-methyl-2-[(1-methylpyrazol-4-yl)sulfonylamino]butanoate (PubChem CID 43624162) has the molecular formula C10H17N3O4S and a molecular weight of 275.33 g/mol. Its IUPAC name is methyl 3-methyl-2-[(1-methylpyrazol-4-yl)sulfonylamino]butanoate.
| Compound Name | methyl 3-methyl-2-[(1-methylpyrazol-4-yl)sulfonylamino]butanoate |
|---|---|
| PubChem CID | 43624162 |
| Molecular Formula | C10H17N3O4S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | methyl 3-methyl-2-[(1-methylpyrazol-4-yl)sulfonylamino]butanoate |
| SMILES | COC(=O)C(NS(=O)(=O)c1cnn(C)c1)C(C)C |
| InChI | InChI=1S/C10H17N3O4S/c1-7(2)9(10(14)17-4)12-18(15,16)8-5-11-13(3)6-8/h5-7,9,12H,1-4H3 |
| InChIKey | VZEMIXKTSSCEDQ-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |