C10H11F3N2O2S — CID 43625009
4-methyl-2-propan-2-yl-6-(trifluoromethylsulfanyl)pyrimidine-5-carboxylic acid (PubChem CID 43625009) has the molecular formula C10H11F3N2O2S and a molecular weight of 280.27 g/mol. Its IUPAC name is 4-methyl-2-propan-2-yl-6-(trifluoromethylsulfanyl)pyrimidine-5-carboxylic acid.
| Compound Name | 4-methyl-2-propan-2-yl-6-(trifluoromethylsulfanyl)pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 43625009 |
| Molecular Formula | C10H11F3N2O2S |
| Molecular Weight | 280.27 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 4-methyl-2-propan-2-yl-6-(trifluoromethylsulfanyl)pyrimidine-5-carboxylic acid |
| SMILES | Cc1nc(C(C)C)nc(SC(F)(F)F)c1C(=O)O |
| InChI | InChI=1S/C10H11F3N2O2S/c1-4(2)7-14-5(3)6(9(16)17)8(15-7)18-10(11,12)13/h4H,1-3H3,(H,16,17) |
| InChIKey | AJLNIPOZHRSNIW-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.27 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |