C9H2ClF5N2OS — CID 43625664
5-chloro-4-[(2,3,4,5,6-pentafluorophenoxy)methyl]thiadiazole (PubChem CID 43625664) has the molecular formula C9H2ClF5N2OS and a molecular weight of 316.64 g/mol. Its IUPAC name is 5-chloro-4-[(2,3,4,5,6-pentafluorophenoxy)methyl]thiadiazole.
| Compound Name | 5-chloro-4-[(2,3,4,5,6-pentafluorophenoxy)methyl]thiadiazole |
|---|---|
| PubChem CID | 43625664 |
| Molecular Formula | C9H2ClF5N2OS |
| Molecular Weight | 316.64 g/mol |
| Exact Mass | 315.95 |
| IUPAC Name | 5-chloro-4-[(2,3,4,5,6-pentafluorophenoxy)methyl]thiadiazole |
| SMILES | Fc1c(F)c(F)c(OCc2nnsc2Cl)c(F)c1F |
| InChI | InChI=1S/C9H2ClF5N2OS/c10-9-2(16-17-19-9)1-18-8-6(14)4(12)3(11)5(13)7(8)15/h1H2 |
| InChIKey | YOKAQDQNAGFDQB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.64 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|