C11H18N4O2S2 — CID 43625851
N-[2-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methylamino]ethyl]methanesulfonamide (PubChem CID 43625851) has the molecular formula C11H18N4O2S2 and a molecular weight of 302.43 g/mol. Its IUPAC name is N-[2-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methylamino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methylamino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 43625851 |
| Molecular Formula | C11H18N4O2S2 |
| Molecular Weight | 302.43 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | N-[2-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methylamino]ethyl]methanesulfonamide |
| SMILES | Cc1cn2c(CNCCNS(C)(=O)=O)c(C)nc2s1 |
| InChI | InChI=1S/C11H18N4O2S2/c1-8-7-15-10(9(2)14-11(15)18-8)6-12-4-5-13-19(3,16)17/h7,12-13H,4-6H2,1-3H3 |
| InChIKey | TZEQDXKMFXHORK-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 75.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.43 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|