C16H20N4S — CID 43625921
1-N-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-4-N,4-N-dimethylbenzene-1,4-diamine (PubChem CID 43625921) has the molecular formula C16H20N4S and a molecular weight of 300.43 g/mol. Its IUPAC name is 1-N-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-4-N,4-N-dimethylbenzene-1,4-diamine.
| Compound Name | 1-N-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-4-N,4-N-dimethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 43625921 |
| Molecular Formula | C16H20N4S |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 1-N-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-4-N,4-N-dimethylbenzene-1,4-diamine |
| SMILES | Cc1cn2c(CNc3ccc(N(C)C)cc3)c(C)nc2s1 |
| InChI | InChI=1S/C16H20N4S/c1-11-10-20-15(12(2)18-16(20)21-11)9-17-13-5-7-14(8-6-13)19(3)4/h5-8,10,17H,9H2,1-4H3 |
| InChIKey | LEFVPOGBIRFTCE-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 32.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|