C11H10BrF3O3 — CID 43627010
3-bromo-5-ethoxy-4-(2,2,2-trifluoroethoxy)benzaldehyde (PubChem CID 43627010) has the molecular formula C11H10BrF3O3 and a molecular weight of 327.10 g/mol. Its IUPAC name is 3-bromo-5-ethoxy-4-(2,2,2-trifluoroethoxy)benzaldehyde.
| Compound Name | 3-bromo-5-ethoxy-4-(2,2,2-trifluoroethoxy)benzaldehyde |
|---|---|
| PubChem CID | 43627010 |
| Molecular Formula | C11H10BrF3O3 |
| Molecular Weight | 327.10 g/mol |
| Exact Mass | 325.98 |
| IUPAC Name | 3-bromo-5-ethoxy-4-(2,2,2-trifluoroethoxy)benzaldehyde |
| SMILES | CCOc1cc(C=O)cc(Br)c1OCC(F)(F)F |
| InChI | InChI=1S/C11H10BrF3O3/c1-2-17-9-4-7(5-16)3-8(12)10(9)18-6-11(13,14)15/h3-5H,2,6H2,1H3 |
| InChIKey | ZZAHSKZIILVSMP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.10 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|