C16H25N3O — CID 43627994
1-[2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)ethyl]-5-aminopyridin-2-one (PubChem CID 43627994) has the molecular formula C16H25N3O and a molecular weight of 275.40 g/mol. Its IUPAC name is 1-[2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)ethyl]-5-aminopyridin-2-one.
| Compound Name | 1-[2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)ethyl]-5-aminopyridin-2-one |
|---|---|
| PubChem CID | 43627994 |
| Molecular Formula | C16H25N3O |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | 1-[2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)ethyl]-5-aminopyridin-2-one |
| SMILES | Nc1ccc(=O)n(CCN2CCCC3CCCCC32)c1 |
| InChI | InChI=1S/C16H25N3O/c17-14-7-8-16(20)19(12-14)11-10-18-9-3-5-13-4-1-2-6-15(13)18/h7-8,12-13,15H,1-6,9-11,17H2 |
| InChIKey | LVVJVIMZLGMSDS-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 51.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |