C12H11N5 — CID 43628629
2-methyl-5-([1,2,4]triazolo[4,3-a]pyrimidin-3-yl)aniline (PubChem CID 43628629) has the molecular formula C12H11N5 and a molecular weight of 225.25 g/mol. Its IUPAC name is 2-methyl-5-([1,2,4]triazolo[4,3-a]pyrimidin-3-yl)aniline.
| Compound Name | 2-methyl-5-([1,2,4]triazolo[4,3-a]pyrimidin-3-yl)aniline |
|---|---|
| PubChem CID | 43628629 |
| Molecular Formula | C12H11N5 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 2-methyl-5-([1,2,4]triazolo[4,3-a]pyrimidin-3-yl)aniline |
| SMILES | Cc1ccc(-c2nnc3ncccn23)cc1N |
| InChI | InChI=1S/C12H11N5/c1-8-3-4-9(7-10(8)13)11-15-16-12-14-5-2-6-17(11)12/h2-7H,13H2,1H3 |
| InChIKey | WQZCVNWUCTYEAQ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|