About 6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-sulfonamide
6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-sulfonamide (PubChem CID 43629159) has the molecular formula C7H7F3N2O3S
and a molecular weight of 256.21 g/mol. Its IUPAC name is 6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-sulfonamide.
Molecular Properties
| Compound Name | 6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-sulfonamide |
| PubChem CID | 43629159 |
| Molecular Formula | C7H7F3N2O3S |
| Molecular Weight | 256.21 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | 6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-sulfonamide |
| SMILES | O=c1ccc(S(=O)(=O)NCC(F)(F)F)c[nH]1 |
| InChI | InChI=1S/C7H7F3N2O3S/c8-7(9,10)4-12-16(14,15)5-1-2-6(13)11-3-5/h1-3,12H,4H2,(H,11,13) |
| InChIKey | YARCRHLLUNYEAR-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.21 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-sulfonamide?
The IUPAC name of 6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-sulfonamide (CID 43629159) is 6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-sulfonamide.
What is the SMILES notation for 6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-sulfonamide?
The canonical SMILES for 6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-sulfonamide is O=c1ccc(S(=O)(=O)NCC(F)(F)F)c[nH]1.
What is the InChIKey of 6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-sulfonamide?
The InChIKey is YARCRHLLUNYEAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7F3N2O3S/c8-7(9,10)4-12-16(14,15)5-1-2-6(13)11-3-5/h1-3,12H,4H2,(H,11,13).
What are the key properties of 6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-sulfonamide?
6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-sulfonamide has a molecular weight of 256.21 g/mol, XLogP of 0.22, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-sulfonamide is sourced from PubChem (CID 43629159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).