C11H14F3N3O3S — CID 43629454
5-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]sulfonyl-1H-pyridin-2-one (PubChem CID 43629454) has the molecular formula C11H14F3N3O3S and a molecular weight of 325.31 g/mol. Its IUPAC name is 5-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]sulfonyl-1H-pyridin-2-one.
| Compound Name | 5-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]sulfonyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 43629454 |
| Molecular Formula | C11H14F3N3O3S |
| Molecular Weight | 325.31 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 5-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]sulfonyl-1H-pyridin-2-one |
| SMILES | O=c1ccc(S(=O)(=O)N2CCN(CC(F)(F)F)CC2)c[nH]1 |
| InChI | InChI=1S/C11H14F3N3O3S/c12-11(13,14)8-16-3-5-17(6-4-16)21(19,20)9-1-2-10(18)15-7-9/h1-2,7H,3-6,8H2,(H,15,18) |
| InChIKey | GRIVISOWZGQWGG-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.31 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |