C14H15BrFNO3 — CID 43630606
2-[[(E)-3-(5-bromo-2-fluorophenyl)prop-2-enoyl]amino]pentanoic acid (PubChem CID 43630606) has the molecular formula C14H15BrFNO3 and a molecular weight of 344.18 g/mol. Its IUPAC name is 2-[[(E)-3-(5-bromo-2-fluorophenyl)prop-2-enoyl]amino]pentanoic acid.
| Compound Name | 2-[[(E)-3-(5-bromo-2-fluorophenyl)prop-2-enoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 43630606 |
| Molecular Formula | C14H15BrFNO3 |
| Molecular Weight | 344.18 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | 2-[[(E)-3-(5-bromo-2-fluorophenyl)prop-2-enoyl]amino]pentanoic acid |
| SMILES | CCCC(NC(=O)/C=C/c1cc(Br)ccc1F)C(=O)O |
| InChI | InChI=1S/C14H15BrFNO3/c1-2-3-12(14(19)20)17-13(18)7-4-9-8-10(15)5-6-11(9)16/h4-8,12H,2-3H2,1H3,(H,17,18)(H,19,20)/b7-4+ |
| InChIKey | VFYHGDDSCDKBRH-QPJJXVBHSA-N |
| XLogP | 2.97 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.18 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|