C13H15N3O3 — CID 43630934
2-(imidazo[1,2-a]pyridine-2-carbonylamino)pentanoic acid (PubChem CID 43630934) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is 2-(imidazo[1,2-a]pyridine-2-carbonylamino)pentanoic acid.
| Compound Name | 2-(imidazo[1,2-a]pyridine-2-carbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 43630934 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 2-(imidazo[1,2-a]pyridine-2-carbonylamino)pentanoic acid |
| SMILES | CCCC(NC(=O)c1cn2ccccc2n1)C(=O)O |
| InChI | InChI=1S/C13H15N3O3/c1-2-5-9(13(18)19)15-12(17)10-8-16-7-4-3-6-11(16)14-10/h3-4,6-9H,2,5H2,1H3,(H,15,17)(H,18,19) |
| InChIKey | RYIRGULXVOYUNA-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |